CAS 856783-37-4 is the registry number for Carbazochrome Impurity 15 Sodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 1-methyl-5,6-dioxo-2,3-dihydroindole-2-sulfonate (CAS 856783-37-4) is a chemical compound with the molecular formula C9H8NNaO5S and a molecular weight of 265.22 g/mol. IUPAC name: sodium 1-methyl-5,6-dioxo-2,3-dihydroindole-2-sulfonate. InChIKey: MWHXMGPWHUGUQQ-UHFFFAOYSA-M.
| Molecular formula | C9H8NNaO5S |
|---|---|
| Molecular weight | 265.22 g/mol |
| IUPAC name | sodium 1-methyl-5,6-dioxo-2,3-dihydroindole-2-sulfonate |
| InChIKey | MWHXMGPWHUGUQQ-UHFFFAOYSA-M |
| SMILES | CN1C(CC2=CC(=O)C(=O)C=C21)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)