CAS 856806-35-4 is the registry number for Mono(4-Methyl-2-pentyl) Phthalate. Offered by: TRC. Available pack sizes: 1g.
2-(4-methylpentan-2-yloxycarbonyl)benzoate (CAS 856806-35-4) is a chemical compound with the molecular formula C14H17O4- and a molecular weight of 249.28 g/mol. IUPAC name: 2-(4-methylpentan-2-yloxycarbonyl)benzoate. InChIKey: WBCHJVGWGRPPOT-UHFFFAOYSA-M.
| Molecular formula | C14H17O4- |
|---|---|
| Molecular weight | 249.28 g/mol |
| IUPAC name | 2-(4-methylpentan-2-yloxycarbonyl)benzoate |
| InChIKey | WBCHJVGWGRPPOT-UHFFFAOYSA-M |
| SMILES | CC(C)CC(C)OC(=O)C1=CC=CC=C1C(=O)[O-] |
Computed by PubChem (NCBI)