CAS 856867-41-9 appears in our catalog under these names: Tedizolid Impurity 31, Tedizolid Impurity 12. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(5R)-3-[3-fluoro-4-[6-(1-methyltetrazol-5-yl)-3-pyridinyl]phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS 856867-41-9) is a chemical compound with the molecular formula C17H15FN6O3 and a molecular weight of 370.3 g/mol. IUPAC name: (5R)-3-[3-fluoro-4-[6-(1-methyltetrazol-5-yl)-3-pyridinyl]phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one. InChIKey: WFAZKGCKGCUHAN-GFCCVEGCSA-N.
| Molecular formula | C17H15FN6O3 |
|---|---|
| Molecular weight | 370.3 g/mol |
| IUPAC name | (5R)-3-[3-fluoro-4-[6-(1-methyltetrazol-5-yl)-3-pyridinyl]phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| InChIKey | WFAZKGCKGCUHAN-GFCCVEGCSA-N |
| SMILES | CN1C(=NN=N1)C2=NC=C(C=C2)C3=C(C=C(C=C3)N4C[C@@H](OC4=O)CO)F |
Computed by PubChem (NCBI)