Products 856869-03-9
CAS 856869-03-9 is the registry number for sym-Homo Spermidine-d4 Trihydrochloride (Major), >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
N'-(4-amino-4,4-dideuteriobutyl)-1,1-dideuteriobutane-1,4-diamine (CAS 856869-03-9) is a chemical compound with the molecular formula C8H21N3 and a molecular weight of 163.30 g/mol. IUPAC name: N'-(4-amino-4,4-dideuteriobutyl)-1,1-dideuteriobutane-1,4-diamine. InChIKey: UODZHRGDSPLRMD-NZLXMSDQSA-N.
| Molecular formula | C8H21N3 |
|---|---|
| Molecular weight | 163.30 g/mol |
| IUPAC name | N'-(4-amino-4,4-dideuteriobutyl)-1,1-dideuteriobutane-1,4-diamine |
| InChIKey | UODZHRGDSPLRMD-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(CCCNCCCC([2H])([2H])N)N |
Computed by PubChem (NCBI)