Products 856973-53-0

CAS 856973-53-0 is the registry number for 4-Amino-5-((dithiocarboxyamino)methyl)-2-methypyrimidine Ammonium Salt. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

(4-amino-2-methylpyrimidin-5-yl)methylcarbamodithioic acid;azane (CAS 856973-53-0) is a chemical compound with the molecular formula C7H13N5S2 and a molecular weight of 231.3 g/mol. IUPAC name: (4-amino-2-methylpyrimidin-5-yl)methylcarbamodithioic acid;azane. InChIKey: DHHFRGSBVNHZKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13N5S2
Molecular weight231.3 g/mol
IUPAC name(4-amino-2-methylpyrimidin-5-yl)methylcarbamodithioic acid;azane
InChIKeyDHHFRGSBVNHZKJ-UHFFFAOYSA-N
SMILESCC1=NC=C(C(=N1)N)CNC(=S)S.N

Computed by PubChem (NCBI)