CAS 856973-53-0 is the registry number for 4-Amino-5-((dithiocarboxyamino)methyl)-2-methypyrimidine Ammonium Salt. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
(4-amino-2-methylpyrimidin-5-yl)methylcarbamodithioic acid;azane (CAS 856973-53-0) is a chemical compound with the molecular formula C7H13N5S2 and a molecular weight of 231.3 g/mol. IUPAC name: (4-amino-2-methylpyrimidin-5-yl)methylcarbamodithioic acid;azane. InChIKey: DHHFRGSBVNHZKJ-UHFFFAOYSA-N.
| Molecular formula | C7H13N5S2 |
|---|---|
| Molecular weight | 231.3 g/mol |
| IUPAC name | (4-amino-2-methylpyrimidin-5-yl)methylcarbamodithioic acid;azane |
| InChIKey | DHHFRGSBVNHZKJ-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=N1)N)CNC(=S)S.N |
Computed by PubChem (NCBI)