CAS 857070-96-3 appears in our catalog under these names: 3–(cis–2,6–dimethyl–4–morpholinyl)–1–propanamine, 3-(cis-2,6-Dimethyl-4-morpholinyl)-1-propanamine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-1-amine (CAS 857070-96-3) is a chemical compound with the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. IUPAC name: 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-1-amine. InChIKey: NIFZHABTMWBHTG-DTORHVGOSA-N.
| Molecular formula | C9H20N2O |
|---|---|
| Molecular weight | 172.27 g/mol |
| IUPAC name | 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-1-amine |
| InChIKey | NIFZHABTMWBHTG-DTORHVGOSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CCCN |
Computed by PubChem (NCBI)