CAS 85710-66-3 appears in our catalog under these names: (5S)-2,3-Dimethyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one, 95% mix TBC as stabilizer, (5S)-2,3-Dimethyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(5S)-2,3-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (CAS 85710-66-3) is a chemical compound with the molecular formula C11H16O and a molecular weight of 164.24 g/mol. IUPAC name: (5S)-2,3-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one. InChIKey: CNIGYRRBFLTZNO-JTQLQIEISA-N.
| Molecular formula | C11H16O |
|---|---|
| Molecular weight | 164.24 g/mol |
| IUPAC name | (5S)-2,3-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| InChIKey | CNIGYRRBFLTZNO-JTQLQIEISA-N |
| SMILES | CC1=C(C(=O)C[C@H](C1)C(=C)C)C |
Computed by PubChem (NCBI)