CAS 85718-09-8 appears in our catalog under these names: Dichloro bis(1,10-phenanthroline) ruthenium, 95+%, 95+%, Dichloro bis(1,10-phenanthroline) ruthenium, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Dichlororuthenium;bis(1,10-phenanthroline) (CAS 85718-09-8) is a chemical compound with the molecular formula C24H16Cl2N4Ru and a molecular weight of 532.4 g/mol. IUPAC name: dichlororuthenium;bis(1,10-phenanthroline). InChIKey: YVRUOGJYITWLPZ-UHFFFAOYSA-L.
| Molecular formula | C24H16Cl2N4Ru |
|---|---|
| Molecular weight | 532.4 g/mol |
| IUPAC name | dichlororuthenium;bis(1,10-phenanthroline) |
| InChIKey | YVRUOGJYITWLPZ-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.Cl[Ru]Cl |
Computed by PubChem (NCBI)