CAS 857186-81-3 is the registry number for Pentafluorophenylphosphate. Offered by: TRC. Available pack sizes: 250mg.
(2,3,4,5,6-pentafluorophenyl) dihydrogen phosphate (CAS 857186-81-3) is a chemical compound with the molecular formula C6H2F5O4P and a molecular weight of 264.04 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) dihydrogen phosphate. InChIKey: CDJCWEPKSBUOBR-UHFFFAOYSA-N.
| Molecular formula | C6H2F5O4P |
|---|---|
| Molecular weight | 264.04 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) dihydrogen phosphate |
| InChIKey | CDJCWEPKSBUOBR-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)OP(=O)(O)O |
Computed by PubChem (NCBI)