CAS 857213-31-1 is the registry number for 2-Hydroxy-2-(p-methoxyphenethyl)-Levulinic Acid Hydrate. Offered by: TRC. Available pack sizes: 1g.
1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;2-hydroxypropanoic acid (CAS 857213-31-1) is a chemical compound with the molecular formula C20H24FN3O6 and a molecular weight of 421.4 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;2-hydroxypropanoic acid. InChIKey: NRBJWZSFNGZBFQ-UHFFFAOYSA-N.
| Molecular formula | C20H24FN3O6 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;2-hydroxypropanoic acid |
| InChIKey | NRBJWZSFNGZBFQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)O.C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O |
Computed by PubChem (NCBI)