CAS 857251-07-1 appears in our catalog under these names: 2-(6-iodo-2-methyl-3H-inden-1-yl)acetic acid, 97%, 97%, 2-(6-iodo-2-methyl-3H-inden-1-yl)acetic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-(6-iodo-2-methyl-3H-inden-1-yl)acetic acid (CAS 857251-07-1) is a chemical compound with the molecular formula C12H11IO2 and a molecular weight of 314.12 g/mol. IUPAC name: 2-(6-iodo-2-methyl-3H-inden-1-yl)acetic acid. InChIKey: MCVXEMLOIFYIKA-UHFFFAOYSA-N.
| Molecular formula | C12H11IO2 |
|---|---|
| Molecular weight | 314.12 g/mol |
| IUPAC name | 2-(6-iodo-2-methyl-3H-inden-1-yl)acetic acid |
| InChIKey | MCVXEMLOIFYIKA-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C1)C=CC(=C2)I)CC(=O)O |
Computed by PubChem (NCBI)