CAS 857283-05-7 is the registry number for Bisphenol A Bissulfate Diammonium Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
Diazanium;[4-[2-(4-sulfonatooxyphenyl)propan-2-yl]phenyl] sulfate (CAS 857283-05-7) is a chemical compound with the molecular formula C15H22N2O8S2 and a molecular weight of 422.5 g/mol. IUPAC name: diazanium;[4-[2-(4-sulfonatooxyphenyl)propan-2-yl]phenyl] sulfate. InChIKey: HVOPCNUOROLILR-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O8S2 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | diazanium;[4-[2-(4-sulfonatooxyphenyl)propan-2-yl]phenyl] sulfate |
| InChIKey | HVOPCNUOROLILR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OS(=O)(=O)[O-])C2=CC=C(C=C2)OS(=O)(=O)[O-].[NH4+].[NH4+] |
Computed by PubChem (NCBI)