Products 857283-05-7

CAS 857283-05-7 is the registry number for Bisphenol A Bissulfate Diammonium Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Diazanium;[4-[2-(4-sulfonatooxyphenyl)propan-2-yl]phenyl] sulfate (CAS 857283-05-7) is a chemical compound with the molecular formula C15H22N2O8S2 and a molecular weight of 422.5 g/mol. IUPAC name: diazanium;[4-[2-(4-sulfonatooxyphenyl)propan-2-yl]phenyl] sulfate. InChIKey: HVOPCNUOROLILR-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22N2O8S2
Molecular weight422.5 g/mol
IUPAC namediazanium;[4-[2-(4-sulfonatooxyphenyl)propan-2-yl]phenyl] sulfate
InChIKeyHVOPCNUOROLILR-UHFFFAOYSA-N
SMILESCC(C)(C1=CC=C(C=C1)OS(=O)(=O)[O-])C2=CC=C(C=C2)OS(=O)(=O)[O-].[NH4+].[NH4+]

Computed by PubChem (NCBI)