CAS 857283-68-2 is the registry number for 2-Methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole (CAS 857283-68-2) is a chemical compound with the molecular formula C16H20BNO2S and a molecular weight of 301.2 g/mol. IUPAC name: 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole. InChIKey: XCAUOIGPROQXRG-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO2S |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole |
| InChIKey | XCAUOIGPROQXRG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CSC(=N3)C |
Computed by PubChem (NCBI)