CAS 857284-28-7 is the registry number for 2-[4-(Trifluoromethyl)phenyl]-1,3-thiazole-4-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbonyl chloride (CAS 857284-28-7) is a chemical compound with the molecular formula C11H5ClF3NOS and a molecular weight of 291.68 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbonyl chloride. InChIKey: UTJDFPDNFUKZIS-UHFFFAOYSA-N.
| Molecular formula | C11H5ClF3NOS |
|---|---|
| Molecular weight | 291.68 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carbonyl chloride |
| InChIKey | UTJDFPDNFUKZIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)