CAS 857356-94-6 appears in our catalog under these names: Tetramethyl tBuXPhos, 2-Di-tert-butylphosphino-3,4,5,6-tetramethyl-2',4',6'-triisopropyl-1,1'-biphenyl, Me4-tBu-Xphos 98%, ME4TBUTYLXPHOS CHEMBEADS, ME4TBUXPHOS, 96%. Offered by: GLPBio, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g, 0,5g, 2g, 100mg, 25g.
Ditert-butyl-[2,3,4,5-tetramethyl-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (CAS 857356-94-6) is a chemical compound with the molecular formula C33H53P and a molecular weight of 480.7 g/mol. IUPAC name: ditert-butyl-[2,3,4,5-tetramethyl-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane. InChIKey: RCRYEYMHBHPZQD-UHFFFAOYSA-N.
| Molecular formula | C33H53P |
|---|---|
| Molecular weight | 480.7 g/mol |
| IUPAC name | ditert-butyl-[2,3,4,5-tetramethyl-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| InChIKey | RCRYEYMHBHPZQD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C2=C(C=C(C=C2C(C)C)C(C)C)C(C)C)P(C(C)(C)C)C(C)(C)C)C)C |
Computed by PubChem (NCBI)