CAS 857412-06-7 appears in our catalog under these names: (1,1':4',1'':4'',1'''–quaterphenyl)–4,4'''–dicarbaldehyde, [1,1:4,1:4,1-Quaterphenyl]-4,4-dicarboxaldehyde 98%, [1,1':4',1'':4'',1'''-quaterphenyl]-4,4'''-dicarbaldehyde, 98%, 98%, [1,1':4',1'':4'',1'''-quaterphenyl]-4,4'''-dicarbaldehyde, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
4-[4-[4-(4-formylphenyl)phenyl]phenyl]benzaldehyde (CAS 857412-06-7) is a chemical compound with the molecular formula C26H18O2 and a molecular weight of 362.4 g/mol. IUPAC name: 4-[4-[4-(4-formylphenyl)phenyl]phenyl]benzaldehyde. InChIKey: NDPOXCAWNCWBPK-UHFFFAOYSA-N.
| Molecular formula | C26H18O2 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 4-[4-[4-(4-formylphenyl)phenyl]phenyl]benzaldehyde |
| InChIKey | NDPOXCAWNCWBPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)C=O |
Computed by PubChem (NCBI)