CAS 857475-68-4 is the registry number for 6-(2-thienyl)-2-thioxo-2,3-dihydropyrimidin-4(1{H})-one, 95%. Offered by: AmBeed. Available pack sizes: 10g, 1g, 5g.
2-sulfanylidene-6-thiophen-2-yl-1H-pyrimidin-4-one (CAS 857475-68-4) is a chemical compound with the molecular formula C8H6N2OS2 and a molecular weight of 210.3 g/mol. IUPAC name: 2-sulfanylidene-6-thiophen-2-yl-1H-pyrimidin-4-one. InChIKey: GCRWCKWTDHPWIV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS2 |
|---|---|
| Molecular weight | 210.3 g/mol |
| IUPAC name | 2-sulfanylidene-6-thiophen-2-yl-1H-pyrimidin-4-one |
| InChIKey | GCRWCKWTDHPWIV-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=O)NC(=S)N2 |
Computed by PubChem (NCBI)