Products 857554-56-4

CAS 857554-56-4 is the registry number for 2-(3-Aminophenyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3-aminophenyl)acetic acid;hydrochloride (CAS 857554-56-4) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 2-(3-aminophenyl)acetic acid;hydrochloride. InChIKey: VQUFEJMSXZXZMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO2
Molecular weight187.62 g/mol
IUPAC name2-(3-aminophenyl)acetic acid;hydrochloride
InChIKeyVQUFEJMSXZXZMJ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)N)CC(=O)O.Cl

Computed by PubChem (NCBI)