CAS 857554-56-4 is the registry number for 2-(3-Aminophenyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-(3-aminophenyl)acetic acid;hydrochloride (CAS 857554-56-4) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 2-(3-aminophenyl)acetic acid;hydrochloride. InChIKey: VQUFEJMSXZXZMJ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 2-(3-aminophenyl)acetic acid;hydrochloride |
| InChIKey | VQUFEJMSXZXZMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CC(=O)O.Cl |
Computed by PubChem (NCBI)