CAS 857722-22-6 is the registry number for (E)-3-(2,3,5,6-Tetrafluorophenyl)acrylaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enal (CAS 857722-22-6) is a chemical compound with the molecular formula C9H4F4O and a molecular weight of 204.12 g/mol. IUPAC name: (E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enal. InChIKey: LUBFWRWQOPXXCY-OWOJBTEDSA-N.
| Molecular formula | C9H4F4O |
|---|---|
| Molecular weight | 204.12 g/mol |
| IUPAC name | (E)-3-(2,3,5,6-tetrafluorophenyl)prop-2-enal |
| InChIKey | LUBFWRWQOPXXCY-OWOJBTEDSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)/C=C/C=O)F)F |
Computed by PubChem (NCBI)