Products 857762-10-8
CAS 857762-10-8 appears in our catalog under these names: 6-Chloro-1-tosyl-2,3-dihydroquinolin-4(1H)-one, 98%, 6-chloro-1-(p-tolylsulfonyl)-2,3-dihydroquinolin-4-one, 97%, 97%, 6-chloro-1-(p-tolylsulfonyl)-2,3-dihydroquinolin-4-one, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
6-chloro-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one (CAS 857762-10-8) is a chemical compound with the molecular formula C16H14ClNO3S and a molecular weight of 335.8 g/mol. IUPAC name: 6-chloro-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one. InChIKey: CLAKQSOFQNLKTK-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO3S |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 6-chloro-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one |
| InChIKey | CLAKQSOFQNLKTK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(=O)C3=C2C=CC(=C3)Cl |
Computed by PubChem (NCBI)