CAS 857776-12-6 is the registry number for ((1H-Indol-5-yl)methyl)dimethylamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1H-indol-5-yl)-N,N-dimethylmethanamine (CAS 857776-12-6) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: 1-(1H-indol-5-yl)-N,N-dimethylmethanamine. InChIKey: DWLHRRNZBOFOJP-UHFFFAOYSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 1-(1H-indol-5-yl)-N,N-dimethylmethanamine |
| InChIKey | DWLHRRNZBOFOJP-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC2=C(C=C1)NC=C2 |
Computed by PubChem (NCBI)