Products 857821-46-6

CAS 857821-46-6 is the registry number for 4-Bromo-2,5-dimethyl-3-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-bromo-2,5-dimethylfuran-3-carboxylic acid (CAS 857821-46-6) is a chemical compound with the molecular formula C7H7BrO3 and a molecular weight of 219.03 g/mol. IUPAC name: 4-bromo-2,5-dimethylfuran-3-carboxylic acid. InChIKey: DSUSYVCPBAFOQR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BrO3
Molecular weight219.03 g/mol
IUPAC name4-bromo-2,5-dimethylfuran-3-carboxylic acid
InChIKeyDSUSYVCPBAFOQR-UHFFFAOYSA-N
SMILESCC1=C(C(=C(O1)C)Br)C(=O)O

Computed by PubChem (NCBI)