CAS 857821-46-6 is the registry number for 4-Bromo-2,5-dimethyl-3-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-2,5-dimethylfuran-3-carboxylic acid (CAS 857821-46-6) is a chemical compound with the molecular formula C7H7BrO3 and a molecular weight of 219.03 g/mol. IUPAC name: 4-bromo-2,5-dimethylfuran-3-carboxylic acid. InChIKey: DSUSYVCPBAFOQR-UHFFFAOYSA-N.
| Molecular formula | C7H7BrO3 |
|---|---|
| Molecular weight | 219.03 g/mol |
| IUPAC name | 4-bromo-2,5-dimethylfuran-3-carboxylic acid |
| InChIKey | DSUSYVCPBAFOQR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(O1)C)Br)C(=O)O |
Computed by PubChem (NCBI)