CAS 858-98-0 appears in our catalog under these names: 3-O-Benzyl Estrone, 3–O–Benzyl estrone. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 100mg, 25mg, 50mg, 5mg, 250mg, 500mg.
(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (CAS 858-98-0) is a chemical compound with the molecular formula C25H28O2 and a molecular weight of 360.5 g/mol. IUPAC name: (8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one. InChIKey: MSINETGATWEUAB-AHCIIZGASA-N.
| Molecular formula | C25H28O2 |
|---|---|
| Molecular weight | 360.5 g/mol |
| IUPAC name | (8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| InChIKey | MSINETGATWEUAB-AHCIIZGASA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)