CAS 858024-79-0 is the registry number for 2-Chloro-6-iodonaphthalene, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-chloro-6-iodonaphthalene (CAS 858024-79-0) is a chemical compound with the molecular formula C10H6ClI and a molecular weight of 288.51 g/mol. IUPAC name: 2-chloro-6-iodonaphthalene. InChIKey: LKWKYFPFZOBUIC-UHFFFAOYSA-N.
| Molecular formula | C10H6ClI |
|---|---|
| Molecular weight | 288.51 g/mol |
| IUPAC name | 2-chloro-6-iodonaphthalene |
| InChIKey | LKWKYFPFZOBUIC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)I)C=C1Cl |
Computed by PubChem (NCBI)