Products 85803-34-5
CAS 85803-34-5 is the registry number for 3'-Fluoroaminopterin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]-3-fluorobenzoyl]amino]pentanedioic acid (CAS 85803-34-5) is a chemical compound with the molecular formula C19H19FN8O5 and a molecular weight of 458.4 g/mol. IUPAC name: (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]-3-fluorobenzoyl]amino]pentanedioic acid. InChIKey: SGJMILOGOMOIPG-LBPRGKRZSA-N.
| Molecular formula | C19H19FN8O5 |
|---|---|
| Molecular weight | 458.4 g/mol |
| IUPAC name | (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]-3-fluorobenzoyl]amino]pentanedioic acid |
| InChIKey | SGJMILOGOMOIPG-LBPRGKRZSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)F)NCC2=CN=C3C(=N2)C(=NC(=N3)N)N |
Computed by PubChem (NCBI)