CAS 858128-57-1 appears in our catalog under these names: Succinimidyl-(4-(psoralen-8-yloxy))butyrate, SPB, 98%, 98%, SPB, 98.20%, SPB, 98%. Offered by: Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 50mg, 10mg, 25mg, 100mg, 250mg, 5 mg, 10 mg, 25 mg.
(2,5-dioxopyrrolidin-1-yl) 4-(7-oxofuro[3,2-g]chromen-9-yl)oxybutanoate (CAS 858128-57-1) is a chemical compound with the molecular formula C19H15NO8 and a molecular weight of 385.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-(7-oxofuro[3,2-g]chromen-9-yl)oxybutanoate. InChIKey: ZOMXGWWLJXRQKZ-UHFFFAOYSA-N.
| Molecular formula | C19H15NO8 |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-(7-oxofuro[3,2-g]chromen-9-yl)oxybutanoate |
| InChIKey | ZOMXGWWLJXRQKZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCOC2=C3C(=CC4=C2OC=C4)C=CC(=O)O3 |
Computed by PubChem (NCBI)