Products 858134-23-3
CAS 858134-23-3 appears in our catalog under these names: Vialinin A, Vialinin A/ 99.89% (existing batch purity), Vialinin A, Vialinin A, 99.89% ,, 99.89% ,, Vialinin A, 99.90%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 200mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg.
[3,4-dihydroxy-2,5-bis(4-hydroxyphenyl)-6-(2-phenylacetyl)oxyphenyl] 2-phenylacetate (CAS 858134-23-3) is a chemical compound with the molecular formula C34H26O8 and a molecular weight of 562.6 g/mol. IUPAC name: [3,4-dihydroxy-2,5-bis(4-hydroxyphenyl)-6-(2-phenylacetyl)oxyphenyl] 2-phenylacetate. InChIKey: NOJUKCRPSUMHQQ-UHFFFAOYSA-N.
| Molecular formula | C34H26O8 |
|---|---|
| Molecular weight | 562.6 g/mol |
| IUPAC name | [3,4-dihydroxy-2,5-bis(4-hydroxyphenyl)-6-(2-phenylacetyl)oxyphenyl] 2-phenylacetate |
| InChIKey | NOJUKCRPSUMHQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)OC2=C(C(=C(C(=C2C3=CC=C(C=C3)O)O)O)C4=CC=C(C=C4)O)OC(=O)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)