CAS 858187-19-6 is the registry number for trans Resveratrol-4’-sulfate. Offered by: TRC. Available pack sizes: 10mg.
[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hydrogen sulfate (CAS 858187-19-6) is a chemical compound with the molecular formula C14H12O6S and a molecular weight of 308.31 g/mol. IUPAC name: [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hydrogen sulfate. InChIKey: KOTTWDFKZULRPN-OWOJBTEDSA-N.
| Molecular formula | C14H12O6S |
|---|---|
| Molecular weight | 308.31 g/mol |
| IUPAC name | [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hydrogen sulfate |
| InChIKey | KOTTWDFKZULRPN-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O)O)OS(=O)(=O)O |
Computed by PubChem (NCBI)