Products 858187-19-6

CAS 858187-19-6 is the registry number for trans Resveratrol-4’-sulfate. Offered by: TRC. Available pack sizes: 10mg.

Structural formula: {0} (CAS {1})

[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hydrogen sulfate (CAS 858187-19-6) is a chemical compound with the molecular formula C14H12O6S and a molecular weight of 308.31 g/mol. IUPAC name: [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hydrogen sulfate. InChIKey: KOTTWDFKZULRPN-OWOJBTEDSA-N.

Identity
Molecular formulaC14H12O6S
Molecular weight308.31 g/mol
IUPAC name[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] hydrogen sulfate
InChIKeyKOTTWDFKZULRPN-OWOJBTEDSA-N
SMILESC1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O)O)OS(=O)(=O)O

Computed by PubChem (NCBI)