Products 858187-22-1

CAS 858187-22-1 is the registry number for trans-Resveratrol-3,4',5-trisulfate trisodium salt. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

[4-[(E)-2-(3,5-disulfooxyphenyl)ethenyl]phenyl] hydrogen sulfate (CAS 858187-22-1) is a chemical compound with the molecular formula C14H12O12S3 and a molecular weight of 468.4 g/mol. IUPAC name: [4-[(E)-2-(3,5-disulfooxyphenyl)ethenyl]phenyl] hydrogen sulfate. InChIKey: PTXZZWAYVALFLP-OWOJBTEDSA-N.

Identity
Molecular formulaC14H12O12S3
Molecular weight468.4 g/mol
IUPAC name[4-[(E)-2-(3,5-disulfooxyphenyl)ethenyl]phenyl] hydrogen sulfate
InChIKeyPTXZZWAYVALFLP-OWOJBTEDSA-N
SMILESC1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O

Computed by PubChem (NCBI)