CAS 858187-22-1 is the registry number for trans-Resveratrol-3,4',5-trisulfate trisodium salt. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
[4-[(E)-2-(3,5-disulfooxyphenyl)ethenyl]phenyl] hydrogen sulfate (CAS 858187-22-1) is a chemical compound with the molecular formula C14H12O12S3 and a molecular weight of 468.4 g/mol. IUPAC name: [4-[(E)-2-(3,5-disulfooxyphenyl)ethenyl]phenyl] hydrogen sulfate. InChIKey: PTXZZWAYVALFLP-OWOJBTEDSA-N.
| Molecular formula | C14H12O12S3 |
|---|---|
| Molecular weight | 468.4 g/mol |
| IUPAC name | [4-[(E)-2-(3,5-disulfooxyphenyl)ethenyl]phenyl] hydrogen sulfate |
| InChIKey | PTXZZWAYVALFLP-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O |
Computed by PubChem (NCBI)