CAS 85822-16-8 appears in our catalog under these names: 4-Formylbenzenesulfonyl chloride, 96%, 4-formylbenzene-1-sulfonyl chloride, 4-Formylbenzene-1-sulfonyl chloride 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g, 2g, 10g, 100mg.
4-formylbenzenesulfonyl chloride (CAS 85822-16-8) is a chemical compound with the molecular formula C7H5ClO3S and a molecular weight of 204.63 g/mol. IUPAC name: 4-formylbenzenesulfonyl chloride. InChIKey: MSWSPWGBDIQKKR-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO3S |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 4-formylbenzenesulfonyl chloride |
| InChIKey | MSWSPWGBDIQKKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)