CAS 858344-36-2 is the registry number for Linezolid Impurity 52. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (CAS 858344-36-2) is a chemical compound with the molecular formula C15H19FN2O6S and a molecular weight of 374.4 g/mol. IUPAC name: [3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate. InChIKey: UCVIKCGVGWBTTI-UHFFFAOYSA-N.
| Molecular formula | C15H19FN2O6S |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | [3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| InChIKey | UCVIKCGVGWBTTI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F |
Computed by PubChem (NCBI)