CAS 858369-47-8 appears in our catalog under these names: 3-(2,2,2-Trifluoro-1,1-dihydroxyethyl)-4H-chromen-4-one, 95%, 3-(2,2,2-Trifluoro-1,1-dihydroxyethyl)-4H-chromen-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(2,2,2-trifluoro-1,1-dihydroxyethyl)chromen-4-one (CAS 858369-47-8) is a chemical compound with the molecular formula C11H7F3O4 and a molecular weight of 260.17 g/mol. IUPAC name: 3-(2,2,2-trifluoro-1,1-dihydroxyethyl)chromen-4-one. InChIKey: VATVKGLJKLTZLY-UHFFFAOYSA-N.
| Molecular formula | C11H7F3O4 |
|---|---|
| Molecular weight | 260.17 g/mol |
| IUPAC name | 3-(2,2,2-trifluoro-1,1-dihydroxyethyl)chromen-4-one |
| InChIKey | VATVKGLJKLTZLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CO2)C(C(F)(F)F)(O)O |
Computed by PubChem (NCBI)