Products 858431-27-3

CAS 858431-27-3 is the registry number for 2-Amino-3-chloromethyl pyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(chloromethyl)pyridin-2-amine;hydrochloride (CAS 858431-27-3) is a chemical compound with the molecular formula C6H8Cl2N2 and a molecular weight of 179.04 g/mol. IUPAC name: 3-(chloromethyl)pyridin-2-amine;hydrochloride. InChIKey: TWDVAWGPGZBFPK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8Cl2N2
Molecular weight179.04 g/mol
IUPAC name3-(chloromethyl)pyridin-2-amine;hydrochloride
InChIKeyTWDVAWGPGZBFPK-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)N)CCl.Cl

Computed by PubChem (NCBI)