CAS 858680-24-7 appears in our catalog under these names: 3-Iodo-(1,1'-biphenyl)-4-amine, 98%, 2-Iodo-4-phenylaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-iodo-4-phenylaniline (CAS 858680-24-7) is a chemical compound with the molecular formula C12H10IN and a molecular weight of 295.12 g/mol. IUPAC name: 2-iodo-4-phenylaniline. InChIKey: NBGAGEUWEYBRSR-UHFFFAOYSA-N.
| Molecular formula | C12H10IN |
|---|---|
| Molecular weight | 295.12 g/mol |
| IUPAC name | 2-iodo-4-phenylaniline |
| InChIKey | NBGAGEUWEYBRSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N)I |
Computed by PubChem (NCBI)