CAS 858935-05-4 is the registry number for rac-(1R,2S)-2-Aminocyclopentane-1-carboxamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1S,2R)-2-aminocyclopentane-1-carboxamide;hydrochloride (CAS 858935-05-4) is a chemical compound with the molecular formula C6H13ClN2O and a molecular weight of 164.63 g/mol. IUPAC name: cis-(1S,2R)-2-aminocyclopentane-1-carboxamide;hydrochloride. InChIKey: MONWWZXCWPTRDY-UYXJWNHNSA-N.
| Molecular formula | C6H13ClN2O |
|---|---|
| Molecular weight | 164.63 g/mol |
| IUPAC name | cis-(1S,2R)-2-aminocyclopentane-1-carboxamide;hydrochloride |
| InChIKey | MONWWZXCWPTRDY-UYXJWNHNSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)N)C(=O)N.Cl |
Computed by PubChem (NCBI)