Products 858956-96-4
CAS 858956-96-4 is the registry number for Vanillinbananin. Offered by: GLPBio. Available pack sizes: 5mg.
3-(4-hydroxy-3-methoxyphenyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-1,5,7-triol (CAS 858956-96-4) is a chemical compound with the molecular formula C14H16O8 and a molecular weight of 312.27 g/mol. IUPAC name: 3-(4-hydroxy-3-methoxyphenyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-1,5,7-triol. InChIKey: HEBOXBAVJPCGPL-UHFFFAOYSA-N.
| Molecular formula | C14H16O8 |
|---|---|
| Molecular weight | 312.27 g/mol |
| IUPAC name | 3-(4-hydroxy-3-methoxyphenyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-1,5,7-triol |
| InChIKey | HEBOXBAVJPCGPL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C23OC4(CC(O2)(CC(C4)(O3)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Vanillinbananin, orb1690219