CAS 85903-00-0 appears in our catalog under these names: Benzo(1,2-b:4,5-b')dithiophene-2,6-dicarbaldehyde, 97%, Benzo(1,2–b:4,5–b')dithiophene–2,6–dicarbaldehyde, Benzo[1,2-b:4,5-b']dithiophene-2,6-dicarbaldehyde, 97%, 97%, Benzo[1,2-b:4,5-b']dithiophene-2,6-dicarbaldehyde, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
Thieno[2,3-f][1]benzothiole-2,6-dicarbaldehyde (CAS 85903-00-0) is a chemical compound with the molecular formula C12H6O2S2 and a molecular weight of 246.3 g/mol. IUPAC name: thieno[2,3-f][1]benzothiole-2,6-dicarbaldehyde. InChIKey: ALRNNAIHJVWUDJ-UHFFFAOYSA-N.
| Molecular formula | C12H6O2S2 |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | thieno[2,3-f][1]benzothiole-2,6-dicarbaldehyde |
| InChIKey | ALRNNAIHJVWUDJ-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(SC2=CC3=C1SC(=C3)C=O)C=O |
Computed by PubChem (NCBI)