Products 859213-51-7
CAS 859213-51-7 is the registry number for (S)-tert-Butyl 3-((dimethylamino)methyl)pyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
Tert-butyl (3S)-3-[(dimethylamino)methyl]pyrrolidine-1-carboxylate (CAS 859213-51-7) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl (3S)-3-[(dimethylamino)methyl]pyrrolidine-1-carboxylate. InChIKey: SVFCKPUIJBZBQS-JTQLQIEISA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl (3S)-3-[(dimethylamino)methyl]pyrrolidine-1-carboxylate |
| InChIKey | SVFCKPUIJBZBQS-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)CN(C)C |
Computed by PubChem (NCBI)