CAS 859502-43-5 appears in our catalog under these names: GR 125487 sulfamate, GR 125487 sulfamate, GR125487 (sulfamate). Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
[1-[2-(methanesulfonamido)ethyl]piperidin-4-yl]methyl 5-fluoro-2-methoxy-1H-indole-3-carboxylate;sulfamic acid (CAS 859502-43-5) is a chemical compound with the molecular formula C19H29FN4O8S2 and a molecular weight of 524.6 g/mol. IUPAC name: [1-[2-(methanesulfonamido)ethyl]piperidin-4-yl]methyl 5-fluoro-2-methoxy-1H-indole-3-carboxylate;sulfamic acid. InChIKey: VQJFDBXITIOGJM-UHFFFAOYSA-N.
| Molecular formula | C19H29FN4O8S2 |
|---|---|
| Molecular weight | 524.6 g/mol |
| IUPAC name | [1-[2-(methanesulfonamido)ethyl]piperidin-4-yl]methyl 5-fluoro-2-methoxy-1H-indole-3-carboxylate;sulfamic acid |
| InChIKey | VQJFDBXITIOGJM-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(N1)C=CC(=C2)F)C(=O)OCC3CCN(CC3)CCNS(=O)(=O)C.NS(=O)(=O)O |
Computed by PubChem (NCBI)