CAS 85955-59-5 appears in our catalog under these names: Lisinopril EP Impurity E, Lisinopril, min. 98 %, EP Impurity E, 10 mg, Lisinopril, min. 98 %, EP Impurity E, 25 mg. Offered by: Chemat Brand, Biosynth, Roth. Available pack sizes: on request, 2mg, 1mg, 5mg, 25mg, 10mg.
(2S)-1-[(2S)-6-amino-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (CAS 85955-59-5) is a chemical compound with the molecular formula C21H31N3O5 and a molecular weight of 405.5 g/mol. IUPAC name: (2S)-1-[(2S)-6-amino-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid. InChIKey: RLAWWYSOJDYHDC-KSZLIROESA-N.
| Molecular formula | C21H31N3O5 |
|---|---|
| Molecular weight | 405.5 g/mol |
| IUPAC name | (2S)-1-[(2S)-6-amino-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | RLAWWYSOJDYHDC-KSZLIROESA-N |
| SMILES | C1C[C@H](N(C1)C(=O)[C@H](CCCCN)N[C@H](CCC2=CC=CC=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)