CAS 85955-78-8 appears in our catalog under these names: Vitamin K1 Impurity 129, (2R,3S)-Epoxide Vitamin K1, Phytonadione Impurity 16. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1aR,7aS)-7a-methyl-1a-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphtho[2,3-b]oxirene-2,7-dione (CAS 85955-78-8) is a chemical compound with the molecular formula C31H46O3 and a molecular weight of 466.7 g/mol. IUPAC name: (1aR,7aS)-7a-methyl-1a-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphtho[2,3-b]oxirene-2,7-dione. InChIKey: KUTXFBIHPWIDJQ-BTPXSFBUSA-N.
| Molecular formula | C31H46O3 |
|---|---|
| Molecular weight | 466.7 g/mol |
| IUPAC name | (1aR,7aS)-7a-methyl-1a-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphtho[2,3-b]oxirene-2,7-dione |
| InChIKey | KUTXFBIHPWIDJQ-BTPXSFBUSA-N |
| SMILES | C[C@@H](CCC[C@@H](C)CCC/C(=C/C[C@]12C(=O)C3=CC=CC=C3C(=O)[C@]1(O2)C)/C)CCCC(C)C |
Computed by PubChem (NCBI)