CAS 859933-58-7 is the registry number for 3,3',4,4',5,5'-Hexabromo-2,2'-dinitrobiphenyl. Offered by: TRC. Available pack sizes: 50mg.
1,2,3-tribromo-4-nitro-5-(3,4,5-tribromo-2-nitrophenyl)benzene (CAS 859933-58-7) is a chemical compound with the molecular formula C12H2Br6N2O4 and a molecular weight of 717.6 g/mol. IUPAC name: 1,2,3-tribromo-4-nitro-5-(3,4,5-tribromo-2-nitrophenyl)benzene. InChIKey: XQQXDDARUVUCNY-UHFFFAOYSA-N.
| Molecular formula | C12H2Br6N2O4 |
|---|---|
| Molecular weight | 717.6 g/mol |
| IUPAC name | 1,2,3-tribromo-4-nitro-5-(3,4,5-tribromo-2-nitrophenyl)benzene |
| InChIKey | XQQXDDARUVUCNY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)Br)[N+](=O)[O-])C2=CC(=C(C(=C2[N+](=O)[O-])Br)Br)Br |
Computed by PubChem (NCBI)