CAS 859980-63-5 appears in our catalog under these names: Sodium [(methylsulfonyl)amino]acetate, 95%, Sodium 2-methanesulfonamidoacetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g.
Sodium 2-(methanesulfonamido)acetate (CAS 859980-63-5) is a chemical compound with the molecular formula C3H6NNaO4S and a molecular weight of 175.14 g/mol. IUPAC name: sodium 2-(methanesulfonamido)acetate. InChIKey: KWLQFYHCUCYLNE-UHFFFAOYSA-M.
| Molecular formula | C3H6NNaO4S |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | sodium 2-(methanesulfonamido)acetate |
| InChIKey | KWLQFYHCUCYLNE-UHFFFAOYSA-M |
| SMILES | CS(=O)(=O)NCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)