CAS 86-39-5 appears in our catalog under these names: 2-Chlorothioxanthone, 98%, Chlorprothixene EP Impurity E, 2-Chlorothioxanthone, >95% (HPLC), 2-Chloro-9H-thioxanthen-9-one, 2–Chlorothioxanthone. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Dr. Ehrenstorfer. Available pack sizes: 100g, 500g, 25g, 5g, on request, 10g, 4x25mg, 25mg.
2-chlorothioxanthen-9-one (CAS 86-39-5) is a chemical compound with the molecular formula C13H7ClOS and a molecular weight of 246.71 g/mol. IUPAC name: 2-chlorothioxanthen-9-one. InChIKey: ZCDADJXRUCOCJE-UHFFFAOYSA-N.
| Molecular formula | C13H7ClOS |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 2-chlorothioxanthen-9-one |
| InChIKey | ZCDADJXRUCOCJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)