CAS 860236-13-1 appears in our catalog under these names: 7-Chloro-3-iodo-4-quinolinol, 4-Hydroxy-7-chloro-3-iodoquinoline. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1g.
7-chloro-3-iodo-1H-quinolin-4-one (CAS 860236-13-1) is a chemical compound with the molecular formula C9H5ClINO and a molecular weight of 305.50 g/mol. IUPAC name: 7-chloro-3-iodo-1H-quinolin-4-one. InChIKey: POLASDJYPIWKKS-UHFFFAOYSA-N.
| Molecular formula | C9H5ClINO |
|---|---|
| Molecular weight | 305.50 g/mol |
| IUPAC name | 7-chloro-3-iodo-1H-quinolin-4-one |
| InChIKey | POLASDJYPIWKKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC=C(C2=O)I |
Computed by PubChem (NCBI)