Products 860379-06-2

CAS 860379-06-2 is the registry number for 1,3-Dimethylcyclopentane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1,3-dimethylcyclopentane-1-carboxylic acid (CAS 860379-06-2) is a chemical compound with the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. IUPAC name: 1,3-dimethylcyclopentane-1-carboxylic acid. InChIKey: MNBGIYKPOPYYSB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14O2
Molecular weight142.20 g/mol
IUPAC name1,3-dimethylcyclopentane-1-carboxylic acid
InChIKeyMNBGIYKPOPYYSB-UHFFFAOYSA-N
SMILESCC1CCC(C1)(C)C(=O)O

Computed by PubChem (NCBI)