Products 86046-11-9
CAS 86046-11-9 is the registry number for (3R,7AS)-3-(tert-butyl)-7a-methyltetrahydro-1H,3H-pyrrolo[1,2-c]oxazol-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,7aS)-3-tert-butyl-7a-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one (CAS 86046-11-9) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: (3R,7aS)-3-tert-butyl-7a-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one. InChIKey: VQVJNVDGTWMQEX-KCJUWKMLSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | (3R,7aS)-3-tert-butyl-7a-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
| InChIKey | VQVJNVDGTWMQEX-KCJUWKMLSA-N |
| SMILES | C[C@@]12CCCN1[C@H](OC2=O)C(C)(C)C |
Computed by PubChem (NCBI)