CAS 860537-84-4 is the registry number for 1-(4-(Benzyloxy)phenyl)-2,2-dibromoethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(4-phenylmethoxyphenyl)ethanone (CAS 860537-84-4) is a chemical compound with the molecular formula C15H12Br2O2 and a molecular weight of 384.06 g/mol. IUPAC name: 2,2-dibromo-1-(4-phenylmethoxyphenyl)ethanone. InChIKey: OYDZKYCBSCLVMU-UHFFFAOYSA-N.
| Molecular formula | C15H12Br2O2 |
|---|---|
| Molecular weight | 384.06 g/mol |
| IUPAC name | 2,2-dibromo-1-(4-phenylmethoxyphenyl)ethanone |
| InChIKey | OYDZKYCBSCLVMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(=O)C(Br)Br |
Computed by PubChem (NCBI)