CAS 86060-94-8 appears in our catalog under these names: Fmoc–Met–OPfp, Fmoc-Met-OPfp 95% HPLC, Fmoc-Met-OPfp, 95%, 95%, Fmoc-Met-OPfp, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 250mg.
(2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfanylbutanoate (CAS 86060-94-8) is a chemical compound with the molecular formula C26H20F5NO4S and a molecular weight of 537.5 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfanylbutanoate. InChIKey: OKDPSRDTLNXPFQ-SFHVURJKSA-N.
| Molecular formula | C26H20F5NO4S |
|---|---|
| Molecular weight | 537.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfanylbutanoate |
| InChIKey | OKDPSRDTLNXPFQ-SFHVURJKSA-N |
| SMILES | CSCC[C@@H](C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)