CAS 86060-99-3 appears in our catalog under these names: Fmoc-asn-opfp, 97%, Fmoc–Asn–OPfp, Fmoc-Asn-OPfp. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 25g, 1g, 25mg, 5mg.
(2,3,4,5,6-pentafluorophenyl) (2S)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate (CAS 86060-99-3) is a chemical compound with the molecular formula C25H17F5N2O5 and a molecular weight of 520.4 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) (2S)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate. InChIKey: FESVUEALWMQZEP-INIZCTEOSA-N.
| Molecular formula | C25H17F5N2O5 |
|---|---|
| Molecular weight | 520.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) (2S)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate |
| InChIKey | FESVUEALWMQZEP-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)N)C(=O)OC4=C(C(=C(C(=C4F)F)F)F)F |
Computed by PubChem (NCBI)